C32H46N4O6 — CID 163084718
1-[5-[2-(3-ethyl-5-oxopentyl)-7-(4-hydroxy-3-methoxyphenyl)-5-oxohept-3-enyl]-2-hydroxy-3-[2-(methylamino)ethoxy]phenyl]-2-methylguanidine (PubChem CID 163084718) has the molecular formula C32H46N4O6 and a molecular weight of 582.74 g/mol. Its IUPAC name is 1-[5-[2-(3-ethyl-5-oxopentyl)-7-(4-hydroxy-3-methoxyphenyl)-5-oxohept-3-enyl]-2-hydroxy-3-[2-(methylamino)ethoxy]phenyl]-2-methylguanidine.
| Compound Name | 1-[5-[2-(3-ethyl-5-oxopentyl)-7-(4-hydroxy-3-methoxyphenyl)-5-oxohept-3-enyl]-2-hydroxy-3-[2-(methylamino)ethoxy]phenyl]-2-methylguanidine |
|---|---|
| PubChem CID | 163084718 |
| Molecular Formula | C32H46N4O6 |
| Molecular Weight | 582.74 g/mol |
| Exact Mass | 582.34 |
| IUPAC Name | 1-[5-[2-(3-ethyl-5-oxopentyl)-7-(4-hydroxy-3-methoxyphenyl)-5-oxohept-3-enyl]-2-hydroxy-3-[2-(methylamino)ethoxy]phenyl]-2-methylguanidine |
| SMILES | CCC(CC=O)CCC(C=CC(=O)CCc1ccc(O)c(OC)c1)Cc1cc(N/C(N)=N/C)c(O)c(OCCNC)c1 |
| InChI | InChI=1S/C32H46N4O6/c1-5-22(14-16-37)6-7-23(8-11-26(38)12-9-24-10-13-28(39)29(20-24)41-4)18-25-19-27(36-32(33)35-3)31(40)30(21-25)42-17-15-34-2/h8,10-11,13,16,19-23,34,39-40H,5-7,9,12,14-15,17-18H2,1-4H3,(H3,33,35,36) |
| InChIKey | IAHMUJIPLWETMO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 155.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.74 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|