C32H44N4O7 — CID 162919689
3-[3-[2-hydroxy-5-[7-(4-hydroxy-3-methoxyphenyl)-5-oxohept-3-enyl]-3-[(N'-methylcarbamimidoyl)amino]phenoxy]-3-(methylaminomethyl)cyclopentyl]propanoic acid (PubChem CID 162919689) has the molecular formula C32H44N4O7 and a molecular weight of 596.73 g/mol. Its IUPAC name is 3-[3-[2-hydroxy-5-[7-(4-hydroxy-3-methoxyphenyl)-5-oxohept-3-enyl]-3-[(N'-methylcarbamimidoyl)amino]phenoxy]-3-(methylaminomethyl)cyclopentyl]propanoic acid.
| Compound Name | 3-[3-[2-hydroxy-5-[7-(4-hydroxy-3-methoxyphenyl)-5-oxohept-3-enyl]-3-[(N'-methylcarbamimidoyl)amino]phenoxy]-3-(methylaminomethyl)cyclopentyl]propanoic acid |
|---|---|
| PubChem CID | 162919689 |
| Molecular Formula | C32H44N4O7 |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.32 |
| IUPAC Name | 3-[3-[2-hydroxy-5-[7-(4-hydroxy-3-methoxyphenyl)-5-oxohept-3-enyl]-3-[(N'-methylcarbamimidoyl)amino]phenoxy]-3-(methylaminomethyl)cyclopentyl]propanoic acid |
| SMILES | C/N=C(\N)Nc1cc(CCC=CC(=O)CCc2ccc(O)c(OC)c2)cc(OC2(CNC)CCC(CCC(=O)O)C2)c1O |
| InChI | InChI=1S/C32H44N4O7/c1-34-20-32(15-14-22(19-32)10-13-29(39)40)43-28-18-23(16-25(30(28)41)36-31(33)35-2)6-4-5-7-24(37)11-8-21-9-12-26(38)27(17-21)42-3/h5,7,9,12,16-18,22,34,38,41H,4,6,8,10-11,13-15,19-20H2,1-3H3,(H,39,40)(H3,33,35,36) |
| InChIKey | RXCGVQBVMAKFCA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 175.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|