C18H28O4 — CID 163059421
2-methoxy-4-[2-[(4R,6R)-6-pentyl-1,3-dioxan-4-yl]ethyl]phenol (PubChem CID 163059421) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is 2-methoxy-4-[2-[(4R,6R)-6-pentyl-1,3-dioxan-4-yl]ethyl]phenol.
| Compound Name | 2-methoxy-4-[2-[(4R,6R)-6-pentyl-1,3-dioxan-4-yl]ethyl]phenol |
|---|---|
| PubChem CID | 163059421 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 2-methoxy-4-[2-[(4R,6R)-6-pentyl-1,3-dioxan-4-yl]ethyl]phenol |
| SMILES | CCCCC[C@@H]1C[C@@H](CCc2ccc(O)c(OC)c2)OCO1 |
| InChI | InChI=1S/C18H28O4/c1-3-4-5-6-15-12-16(22-13-21-15)9-7-14-8-10-17(19)18(11-14)20-2/h8,10-11,15-16,19H,3-7,9,12-13H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | JBAPHGKWYYAKIJ-HZPDHXFCSA-N |
| XLogP | 4.05 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|