C27H34O6 — CID 162980102
(2R,4R,4aR,10bS)-2-[2-[4-hydroxy-3-(3-methylbutyl)phenyl]ethyl]-7-methoxy-3,4,4a,10b-tetrahydro-2H-benzo[h]chromene-4,8,9-triol (PubChem CID 162980102) has the molecular formula C27H34O6 and a molecular weight of 454.56 g/mol. Its IUPAC name is (2R,4R,4aR,10bS)-2-[2-[4-hydroxy-3-(3-methylbutyl)phenyl]ethyl]-7-methoxy-3,4,4a,10b-tetrahydro-2H-benzo[h]chromene-4,8,9-triol.
| Compound Name | (2R,4R,4aR,10bS)-2-[2-[4-hydroxy-3-(3-methylbutyl)phenyl]ethyl]-7-methoxy-3,4,4a,10b-tetrahydro-2H-benzo[h]chromene-4,8,9-triol |
|---|---|
| PubChem CID | 162980102 |
| Molecular Formula | C27H34O6 |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | (2R,4R,4aR,10bS)-2-[2-[4-hydroxy-3-(3-methylbutyl)phenyl]ethyl]-7-methoxy-3,4,4a,10b-tetrahydro-2H-benzo[h]chromene-4,8,9-triol |
| SMILES | COc1c(O)c(O)cc2c1C=C[C@@H]1[C@H](O)C[C@@H](CCc3ccc(O)c(CCC(C)C)c3)O[C@H]21 |
| InChI | InChI=1S/C27H34O6/c1-15(2)4-7-17-12-16(6-11-22(17)28)5-8-18-13-23(29)20-10-9-19-21(26(20)33-18)14-24(30)25(31)27(19)32-3/h6,9-12,14-15,18,20,23,26,28-31H,4-5,7-8,13H2,1-3H3/t18-,20-,23-,26+/m1/s1 |
| InChIKey | CJZULQRGPKBCAY-SNMOHMLRSA-N |
| XLogP | 4.87 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|