About dec-3-yn-2-yloxy-diphenyl-trimethylsilylsilane
dec-3-yn-2-yloxy-diphenyl-trimethylsilylsilane (PubChem CID 134884951) has the molecular formula C25H36OSi2
and a molecular weight of 408.73 g/mol. Its IUPAC name is dec-3-yn-2-yloxy-diphenyl-trimethylsilylsilane.
Molecular Properties
| Compound Name | dec-3-yn-2-yloxy-diphenyl-trimethylsilylsilane |
| PubChem CID | 134884951 |
| Molecular Formula | C25H36OSi2 |
| Molecular Weight | 408.73 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | dec-3-yn-2-yloxy-diphenyl-trimethylsilylsilane |
| SMILES | CCCCCCC#CC(C)O[Si](c1ccccc1)(c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C25H36OSi2/c1-6-7-8-9-10-13-18-23(2)26-28(27(3,4)5,24-19-14-11-15-20-24)25-21-16-12-17-22-25/h11-12,14-17,19-23H,6-10H2,1-5H3 |
| InChIKey | KZVDDKSZPCIGBW-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.73 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dec-3-yn-2-yloxy-diphenyl-trimethylsilylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dec-3-yn-2-yloxy-diphenyl-trimethylsilylsilane?
The IUPAC name of dec-3-yn-2-yloxy-diphenyl-trimethylsilylsilane (CID 134884951) is dec-3-yn-2-yloxy-diphenyl-trimethylsilylsilane.
What is the SMILES notation for dec-3-yn-2-yloxy-diphenyl-trimethylsilylsilane?
The canonical SMILES for dec-3-yn-2-yloxy-diphenyl-trimethylsilylsilane is CCCCCCC#CC(C)O[Si](c1ccccc1)(c1ccccc1)[Si](C)(C)C.
What is the InChIKey of dec-3-yn-2-yloxy-diphenyl-trimethylsilylsilane?
The InChIKey is KZVDDKSZPCIGBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H36OSi2/c1-6-7-8-9-10-13-18-23(2)26-28(27(3,4)5,24-19-14-11-15-20-24)25-21-16-12-17-22-25/h11-12,14-17,19-23H,6-10H2,1-5H3.
What are the key properties of dec-3-yn-2-yloxy-diphenyl-trimethylsilylsilane?
dec-3-yn-2-yloxy-diphenyl-trimethylsilylsilane has a molecular weight of 408.73 g/mol, XLogP of 5.54, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dec-3-yn-2-yloxy-diphenyl-trimethylsilylsilane is sourced from PubChem (CID 134884951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).