C18H28Si — CID 162297716
2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl-benzyl-dimethylsilane (PubChem CID 162297716) has the molecular formula C18H28Si and a molecular weight of 272.51 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl-benzyl-dimethylsilane.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl-benzyl-dimethylsilane |
|---|---|
| PubChem CID | 162297716 |
| Molecular Formula | C18H28Si |
| Molecular Weight | 272.51 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl-benzyl-dimethylsilane |
| SMILES | C[Si](C)(Cc1ccccc1)C1CCC2CCCCC21 |
| InChI | InChI=1S/C18H28Si/c1-19(2,14-15-8-4-3-5-9-15)18-13-12-16-10-6-7-11-17(16)18/h3-5,8-9,16-18H,6-7,10-14H2,1-2H3 |
| InChIKey | DHFHCVQFYXROMN-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|