C19H34N2Si — CID 132558806
trans-(1R,2R)-2-N-[[benzyl(dimethyl)silyl]methyl]-1-N,1-N,2-N-trimethylcyclohexane-1,2-diamine (PubChem CID 132558806) has the molecular formula C19H34N2Si and a molecular weight of 318.58 g/mol. Its IUPAC name is trans-(1R,2R)-2-N-[[benzyl(dimethyl)silyl]methyl]-1-N,1-N,2-N-trimethylcyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-2-N-[[benzyl(dimethyl)silyl]methyl]-1-N,1-N,2-N-trimethylcyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 132558806 |
| Molecular Formula | C19H34N2Si |
| Molecular Weight | 318.58 g/mol |
| Exact Mass | 318.25 |
| IUPAC Name | trans-(1R,2R)-2-N-[[benzyl(dimethyl)silyl]methyl]-1-N,1-N,2-N-trimethylcyclohexane-1,2-diamine |
| SMILES | CN(C)[C@@H]1CCCC[C@H]1N(C)C[Si](C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C19H34N2Si/c1-20(2)18-13-9-10-14-19(18)21(3)16-22(4,5)15-17-11-7-6-8-12-17/h6-8,11-12,18-19H,9-10,13-16H2,1-5H3/t18-,19-/m1/s1 |
| InChIKey | VHWZBPOHGMPQFH-RTBURBONSA-N |
| XLogP | 3.82 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|