C21H28NP — CID 158995956
cis-(1S,2S)-N-diphenylphosphanyl-2-ethyl-N-methylcyclohexan-1-amine (PubChem CID 158995956) has the molecular formula C21H28NP and a molecular weight of 325.44 g/mol. Its IUPAC name is cis-(1S,2S)-N-diphenylphosphanyl-2-ethyl-N-methylcyclohexan-1-amine.
| Compound Name | cis-(1S,2S)-N-diphenylphosphanyl-2-ethyl-N-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 158995956 |
| Molecular Formula | C21H28NP |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | cis-(1S,2S)-N-diphenylphosphanyl-2-ethyl-N-methylcyclohexan-1-amine |
| SMILES | CC[C@H]1CCCC[C@@H]1N(C)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H28NP/c1-3-18-12-10-11-17-21(18)22(2)23(19-13-6-4-7-14-19)20-15-8-5-9-16-20/h4-9,13-16,18,21H,3,10-12,17H2,1-2H3/t18-,21-/m0/s1 |
| InChIKey | PKWCMQXTMRTJCI-RXVVDRJESA-N |
| XLogP | 4.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|