C15H24N2 — CID 63861614
2-N-(2-ethylcyclohexyl)-2-N-methylbenzene-1,2-diamine (PubChem CID 63861614) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 2-N-(2-ethylcyclohexyl)-2-N-methylbenzene-1,2-diamine.
| Compound Name | 2-N-(2-ethylcyclohexyl)-2-N-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 63861614 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 2-N-(2-ethylcyclohexyl)-2-N-methylbenzene-1,2-diamine |
| SMILES | CCC1CCCCC1N(C)c1ccccc1N |
| InChI | InChI=1S/C15H24N2/c1-3-12-8-4-6-10-14(12)17(2)15-11-7-5-9-13(15)16/h5,7,9,11-12,14H,3-4,6,8,10,16H2,1-2H3 |
| InChIKey | HWHKLQBIVNPDHM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|