C9H16Cl2N2 — CID 155970662
2-N-ethyl-2-N-methylbenzene-1,2-diamine;dihydrochloride (PubChem CID 155970662) has the molecular formula C9H16Cl2N2 and a molecular weight of 223.15 g/mol. Its IUPAC name is 2-N-ethyl-2-N-methylbenzene-1,2-diamine;dihydrochloride.
| Compound Name | 2-N-ethyl-2-N-methylbenzene-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 155970662 |
| Molecular Formula | C9H16Cl2N2 |
| Molecular Weight | 223.15 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 2-N-ethyl-2-N-methylbenzene-1,2-diamine;dihydrochloride |
| SMILES | CCN(C)c1ccccc1N.Cl.Cl |
| InChI | InChI=1S/C9H14N2.2ClH/c1-3-11(2)9-7-5-4-6-8(9)10;;/h4-7H,3,10H2,1-2H3;2*1H |
| InChIKey | YKPPKIMYCNZZOL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.15 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|