About 2-N-ethyl-2-N-methylbenzene-1,2-diamine;quinoline
2-N-ethyl-2-N-methylbenzene-1,2-diamine;quinoline (PubChem CID 143742378) has the molecular formula C18H21N3
and a molecular weight of 279.39 g/mol. Its IUPAC name is 2-N-ethyl-2-N-methylbenzene-1,2-diamine;quinoline.
Molecular Properties
| Compound Name | 2-N-ethyl-2-N-methylbenzene-1,2-diamine;quinoline |
| PubChem CID | 143742378 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 2-N-ethyl-2-N-methylbenzene-1,2-diamine;quinoline |
| SMILES | CCN(C)c1ccccc1N.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H14N2.C9H7N/c1-3-11(2)9-7-5-4-6-8(9)10;1-2-6-9-8(4-1)5-3-7-10-9/h4-7H,3,10H2,1-2H3;1-7H |
| InChIKey | ZRXWISJOMGUYEX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-N-ethyl-2-N-methylbenzene-1,2-diamine;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-ethyl-2-N-methylbenzene-1,2-diamine;quinoline?
The IUPAC name of 2-N-ethyl-2-N-methylbenzene-1,2-diamine;quinoline (CID 143742378) is 2-N-ethyl-2-N-methylbenzene-1,2-diamine;quinoline.
What is the SMILES notation for 2-N-ethyl-2-N-methylbenzene-1,2-diamine;quinoline?
The canonical SMILES for 2-N-ethyl-2-N-methylbenzene-1,2-diamine;quinoline is CCN(C)c1ccccc1N.c1ccc2ncccc2c1.
What is the InChIKey of 2-N-ethyl-2-N-methylbenzene-1,2-diamine;quinoline?
The InChIKey is ZRXWISJOMGUYEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2.C9H7N/c1-3-11(2)9-7-5-4-6-8(9)10;1-2-6-9-8(4-1)5-3-7-10-9/h4-7H,3,10H2,1-2H3;1-7H.
What are the key properties of 2-N-ethyl-2-N-methylbenzene-1,2-diamine;quinoline?
2-N-ethyl-2-N-methylbenzene-1,2-diamine;quinoline has a molecular weight of 279.39 g/mol, XLogP of 3.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-ethyl-2-N-methylbenzene-1,2-diamine;quinoline is sourced from PubChem (CID 143742378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).