C25H29NP2 — CID 129072832
cis-(1R,2S)-2-benzyl-N-diphenylphosphanyl-N-phosphanylcyclohexan-1-amine (PubChem CID 129072832) has the molecular formula C25H29NP2 and a molecular weight of 405.46 g/mol. Its IUPAC name is cis-(1R,2S)-2-benzyl-N-diphenylphosphanyl-N-phosphanylcyclohexan-1-amine.
| Compound Name | cis-(1R,2S)-2-benzyl-N-diphenylphosphanyl-N-phosphanylcyclohexan-1-amine |
|---|---|
| PubChem CID | 129072832 |
| Molecular Formula | C25H29NP2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | cis-(1R,2S)-2-benzyl-N-diphenylphosphanyl-N-phosphanylcyclohexan-1-amine |
| SMILES | PN([C@@H]1CCCC[C@H]1Cc1ccccc1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H29NP2/c27-26(25-19-11-10-14-22(25)20-21-12-4-1-5-13-21)28(23-15-6-2-7-16-23)24-17-8-3-9-18-24/h1-9,12-13,15-18,22,25H,10-11,14,19-20,27H2/t22-,25+/m0/s1 |
| InChIKey | GEXKKELBOAXESM-WIOPSUGQSA-N |
| XLogP | 5.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|