C25H35NP2 — CID 130394726
cis-(1R,2S)-2-(cyclohexylmethyl)-N-diphenylphosphanyl-N-phosphanylcyclohexan-1-amine (PubChem CID 130394726) has the molecular formula C25H35NP2 and a molecular weight of 411.51 g/mol. Its IUPAC name is cis-(1R,2S)-2-(cyclohexylmethyl)-N-diphenylphosphanyl-N-phosphanylcyclohexan-1-amine.
| Compound Name | cis-(1R,2S)-2-(cyclohexylmethyl)-N-diphenylphosphanyl-N-phosphanylcyclohexan-1-amine |
|---|---|
| PubChem CID | 130394726 |
| Molecular Formula | C25H35NP2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | cis-(1R,2S)-2-(cyclohexylmethyl)-N-diphenylphosphanyl-N-phosphanylcyclohexan-1-amine |
| SMILES | PN([C@@H]1CCCC[C@H]1CC1CCCCC1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H35NP2/c27-26(25-19-11-10-14-22(25)20-21-12-4-1-5-13-21)28(23-15-6-2-7-16-23)24-17-8-3-9-18-24/h2-3,6-9,15-18,21-22,25H,1,4-5,10-14,19-20,27H2/t22-,25+/m0/s1 |
| InChIKey | XQVICFAJQLYWDZ-WIOPSUGQSA-N |
| XLogP | 6.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|