C37H43NP2 — CID 129073733
cis-(1R,2S)-N,N-bis(diphenylphosphanyl)-2-(2-methylcyclohexyl)cyclohexan-1-amine (PubChem CID 129073733) has the molecular formula C37H43NP2 and a molecular weight of 563.71 g/mol. Its IUPAC name is cis-(1R,2S)-N,N-bis(diphenylphosphanyl)-2-(2-methylcyclohexyl)cyclohexan-1-amine.
| Compound Name | cis-(1R,2S)-N,N-bis(diphenylphosphanyl)-2-(2-methylcyclohexyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 129073733 |
| Molecular Formula | C37H43NP2 |
| Molecular Weight | 563.71 g/mol |
| Exact Mass | 563.29 |
| IUPAC Name | cis-(1R,2S)-N,N-bis(diphenylphosphanyl)-2-(2-methylcyclohexyl)cyclohexan-1-amine |
| SMILES | CC1CCCCC1[C@@H]1CCCC[C@H]1N(P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H43NP2/c1-30-18-14-15-27-35(30)36-28-16-17-29-37(36)38(39(31-19-6-2-7-20-31)32-21-8-3-9-22-32)40(33-23-10-4-11-24-33)34-25-12-5-13-26-34/h2-13,19-26,30,35-37H,14-18,27-29H2,1H3/t30?,35?,36-,37+/m0/s1 |
| InChIKey | VFSGUPAJBJRHKI-CEHNLFRSSA-N |
| XLogP | 8.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.71 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|