C16H26Si — CID 136865379
[(2S)-2-deuteriocyclohexyl]-dimethyl-(2-phenylethyl)silane (PubChem CID 136865379) has the molecular formula C16H26Si and a molecular weight of 247.48 g/mol. Its IUPAC name is [(2S)-2-deuteriocyclohexyl]-dimethyl-(2-phenylethyl)silane.
| Compound Name | [(2S)-2-deuteriocyclohexyl]-dimethyl-(2-phenylethyl)silane |
|---|---|
| PubChem CID | 136865379 |
| Molecular Formula | C16H26Si |
| Molecular Weight | 247.48 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | [(2S)-2-deuteriocyclohexyl]-dimethyl-(2-phenylethyl)silane |
| SMILES | [2H][C@H]1CCCCC1[Si](C)(C)CCc1ccccc1 |
| InChI | InChI=1S/C16H26Si/c1-17(2,16-11-7-4-8-12-16)14-13-15-9-5-3-6-10-15/h3,5-6,9-10,16H,4,7-8,11-14H2,1-2H3/i11D/t11-,16?/m0/s1 |
| InChIKey | KGEISZNYPMOFLT-AWIHMGDQSA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|