C15H23BP — CID 11402379
CID 11402379 (PubChem CID 11402379) has the molecular formula C15H23BP and a molecular weight of 245.14 g/mol.
| Compound Name | CID 11402379 |
|---|---|
| PubChem CID | 11402379 |
| Molecular Formula | C15H23BP |
| Molecular Weight | 245.14 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | — |
| SMILES | C[P@](CCc1ccccc1)C1CCCCC1.[B] |
| InChI | InChI=1S/C15H23P.B/c1-16(15-10-6-3-7-11-15)13-12-14-8-4-2-5-9-14;/h2,4-5,8-9,15H,3,6-7,10-13H2,1H3;/t16-;/m1./s1 |
| InChIKey | WBMJOSMSTCKJBP-PKLMIRHRSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.14 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|