C25H43N2P — CID 153316711
N'-tert-butyl-1-dicyclohexylphosphanyl-N-(2-phenylethyl)methanediamine (PubChem CID 153316711) has the molecular formula C25H43N2P and a molecular weight of 402.61 g/mol. Its IUPAC name is N'-tert-butyl-1-dicyclohexylphosphanyl-N-(2-phenylethyl)methanediamine.
| Compound Name | N'-tert-butyl-1-dicyclohexylphosphanyl-N-(2-phenylethyl)methanediamine |
|---|---|
| PubChem CID | 153316711 |
| Molecular Formula | C25H43N2P |
| Molecular Weight | 402.61 g/mol |
| Exact Mass | 402.32 |
| IUPAC Name | N'-tert-butyl-1-dicyclohexylphosphanyl-N-(2-phenylethyl)methanediamine |
| SMILES | CC(C)(C)NC(NCCc1ccccc1)P(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C25H43N2P/c1-25(2,3)27-24(26-20-19-21-13-7-4-8-14-21)28(22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4,7-8,13-14,22-24,26-27H,5-6,9-12,15-20H2,1-3H3 |
| InChIKey | YMRMNXNNOVATDV-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.61 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|