C18H25NO2 — CID 58143112
benzyl 1-amino-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxylate (PubChem CID 58143112) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is benzyl 1-amino-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxylate.
| Compound Name | benzyl 1-amino-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 58143112 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | benzyl 1-amino-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carboxylate |
| SMILES | NC1C(C(=O)OCc2ccccc2)CCC2CCCCC21 |
| InChI | InChI=1S/C18H25NO2/c19-17-15-9-5-4-8-14(15)10-11-16(17)18(20)21-12-13-6-2-1-3-7-13/h1-3,6-7,14-17H,4-5,8-12,19H2 |
| InChIKey | BVJVNZRADRXEQK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |