C17H28OSi — CID 101226731
[(2S,3R,4S,5R)-2,4-dimethyl-5-propan-2-yloxolan-3-yl]-dimethyl-phenylsilane (PubChem CID 101226731) has the molecular formula C17H28OSi and a molecular weight of 276.50 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-2,4-dimethyl-5-propan-2-yloxolan-3-yl]-dimethyl-phenylsilane.
| Compound Name | [(2S,3R,4S,5R)-2,4-dimethyl-5-propan-2-yloxolan-3-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 101226731 |
| Molecular Formula | C17H28OSi |
| Molecular Weight | 276.50 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | [(2S,3R,4S,5R)-2,4-dimethyl-5-propan-2-yloxolan-3-yl]-dimethyl-phenylsilane |
| SMILES | CC(C)[C@H]1O[C@@H](C)[C@H]([Si](C)(C)c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C17H28OSi/c1-12(2)16-13(3)17(14(4)18-16)19(5,6)15-10-8-7-9-11-15/h7-14,16-17H,1-6H3/t13-,14-,16+,17+/m0/s1 |
| InChIKey | ZTICFPIBWWUROU-XJNFMUPTSA-N |
| XLogP | 4.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|