C26H42Si4 — CID 101074188
[7-[dimethyl(phenyl)silyl]-1,7-disilabicyclo[5.5.0]dodecan-1-yl]-dimethyl-phenylsilane (PubChem CID 101074188) has the molecular formula C26H42Si4 and a molecular weight of 466.97 g/mol. Its IUPAC name is [7-[dimethyl(phenyl)silyl]-1,7-disilabicyclo[5.5.0]dodecan-1-yl]-dimethyl-phenylsilane.
| Compound Name | [7-[dimethyl(phenyl)silyl]-1,7-disilabicyclo[5.5.0]dodecan-1-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 101074188 |
| Molecular Formula | C26H42Si4 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | [7-[dimethyl(phenyl)silyl]-1,7-disilabicyclo[5.5.0]dodecan-1-yl]-dimethyl-phenylsilane |
| SMILES | C[Si](C)(c1ccccc1)[Si]12CCCCC[Si]1([Si](C)(C)c1ccccc1)CCCCC2 |
| InChI | InChI=1S/C26H42Si4/c1-27(2,25-17-9-5-10-18-25)29-21-13-7-15-23-30(29,24-16-8-14-22-29)28(3,4)26-19-11-6-12-20-26/h5-6,9-12,17-20H,7-8,13-16,21-24H2,1-4H3 |
| InChIKey | XEWCEHRQDRFROA-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|