C17H22N2Si2 — CID 100943539
N,N'-bis[dimethyl(phenyl)silyl]methanediimine (PubChem CID 100943539) has the molecular formula C17H22N2Si2 and a molecular weight of 310.55 g/mol. Its IUPAC name is N,N'-bis[dimethyl(phenyl)silyl]methanediimine.
| Compound Name | N,N'-bis[dimethyl(phenyl)silyl]methanediimine |
|---|---|
| PubChem CID | 100943539 |
| Molecular Formula | C17H22N2Si2 |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | N,N'-bis[dimethyl(phenyl)silyl]methanediimine |
| SMILES | C[Si](C)(N=C=N[Si](C)(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H22N2Si2/c1-20(2,16-11-7-5-8-12-16)18-15-19-21(3,4)17-13-9-6-10-14-17/h5-14H,1-4H3 |
| InChIKey | SPRNYXMTWUBRMB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|