C23H22N4Si — CID 140624613
N-ethyl-N-triphenylsilyl-1,3,5-triazin-2-amine (PubChem CID 140624613) has the molecular formula C23H22N4Si and a molecular weight of 382.54 g/mol. Its IUPAC name is N-ethyl-N-triphenylsilyl-1,3,5-triazin-2-amine.
| Compound Name | N-ethyl-N-triphenylsilyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 140624613 |
| Molecular Formula | C23H22N4Si |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-ethyl-N-triphenylsilyl-1,3,5-triazin-2-amine |
| SMILES | CCN(c1ncncn1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22N4Si/c1-2-27(23-25-18-24-19-26-23)28(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-19H,2H2,1H3 |
| InChIKey | MSQSSWIUTAGGFI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|