About N-ethyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine
N-ethyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine (PubChem CID 140624663) has the molecular formula C26H31N3Si2
and a molecular weight of 441.73 g/mol. Its IUPAC name is N-ethyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine.
Molecular Properties
| Compound Name | N-ethyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine |
| PubChem CID | 140624663 |
| Molecular Formula | C26H31N3Si2 |
| Molecular Weight | 441.73 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | N-ethyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine |
| SMILES | CCN(c1cnn([Si](C)(C)C)c1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H31N3Si2/c1-5-28(23-21-27-29(22-23)30(2,3)4)31(24-15-9-6-10-16-24,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-22H,5H2,1-4H3 |
| InChIKey | JUCQFPCHZXCAJQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.73 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine?
The IUPAC name of N-ethyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine (CID 140624663) is N-ethyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine.
What is the SMILES notation for N-ethyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine?
The canonical SMILES for N-ethyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine is CCN(c1cnn([Si](C)(C)C)c1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of N-ethyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine?
The InChIKey is JUCQFPCHZXCAJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H31N3Si2/c1-5-28(23-21-27-29(22-23)30(2,3)4)31(24-15-9-6-10-16-24,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-22H,5H2,1-4H3.
What are the key properties of N-ethyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine?
N-ethyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine has a molecular weight of 441.73 g/mol, XLogP of 4.06, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine is sourced from PubChem (CID 140624663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).