About 1-methyl-N-phenyl-N-trimethylsilylpyrazol-4-amine
1-methyl-N-phenyl-N-trimethylsilylpyrazol-4-amine (PubChem CID 140624758) has the molecular formula C13H19N3Si
and a molecular weight of 245.40 g/mol. Its IUPAC name is 1-methyl-N-phenyl-N-trimethylsilylpyrazol-4-amine.
Molecular Properties
| Compound Name | 1-methyl-N-phenyl-N-trimethylsilylpyrazol-4-amine |
| PubChem CID | 140624758 |
| Molecular Formula | C13H19N3Si |
| Molecular Weight | 245.40 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 1-methyl-N-phenyl-N-trimethylsilylpyrazol-4-amine |
| SMILES | Cn1cc(N(c2ccccc2)[Si](C)(C)C)cn1 |
| InChI | InChI=1S/C13H19N3Si/c1-15-11-13(10-14-15)16(17(2,3)4)12-8-6-5-7-9-12/h5-11H,1-4H3 |
| InChIKey | DWKXKUSZZPNCJM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-N-phenyl-N-trimethylsilylpyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-phenyl-N-trimethylsilylpyrazol-4-amine?
The IUPAC name of 1-methyl-N-phenyl-N-trimethylsilylpyrazol-4-amine (CID 140624758) is 1-methyl-N-phenyl-N-trimethylsilylpyrazol-4-amine.
What is the SMILES notation for 1-methyl-N-phenyl-N-trimethylsilylpyrazol-4-amine?
The canonical SMILES for 1-methyl-N-phenyl-N-trimethylsilylpyrazol-4-amine is Cn1cc(N(c2ccccc2)[Si](C)(C)C)cn1.
What is the InChIKey of 1-methyl-N-phenyl-N-trimethylsilylpyrazol-4-amine?
The InChIKey is DWKXKUSZZPNCJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3Si/c1-15-11-13(10-14-15)16(17(2,3)4)12-8-6-5-7-9-12/h5-11H,1-4H3.
What are the key properties of 1-methyl-N-phenyl-N-trimethylsilylpyrazol-4-amine?
1-methyl-N-phenyl-N-trimethylsilylpyrazol-4-amine has a molecular weight of 245.40 g/mol, XLogP of 3.39, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-phenyl-N-trimethylsilylpyrazol-4-amine is sourced from PubChem (CID 140624758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).