C8H17N3Si — CID 140624297
N,1-dimethyl-N-trimethylsilylpyrazol-4-amine (PubChem CID 140624297) has the molecular formula C8H17N3Si and a molecular weight of 183.33 g/mol. Its IUPAC name is N,1-dimethyl-N-trimethylsilylpyrazol-4-amine.
| Compound Name | N,1-dimethyl-N-trimethylsilylpyrazol-4-amine |
|---|---|
| PubChem CID | 140624297 |
| Molecular Formula | C8H17N3Si |
| Molecular Weight | 183.33 g/mol |
| Exact Mass | 183.12 |
| IUPAC Name | N,1-dimethyl-N-trimethylsilylpyrazol-4-amine |
| SMILES | CN(c1cnn(C)c1)[Si](C)(C)C |
| InChI | InChI=1S/C8H17N3Si/c1-10-7-8(6-9-10)11(2)12(3,4)5/h6-7H,1-5H3 |
| InChIKey | UGFHCLZPXXQBDC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|