C8H12BrN3 — CID 75512536
N-(2-bromoprop-2-enyl)-N,1-dimethylpyrazol-4-amine (PubChem CID 75512536) has the molecular formula C8H12BrN3 and a molecular weight of 230.11 g/mol. Its IUPAC name is N-(2-bromoprop-2-enyl)-N,1-dimethylpyrazol-4-amine.
| Compound Name | N-(2-bromoprop-2-enyl)-N,1-dimethylpyrazol-4-amine |
|---|---|
| PubChem CID | 75512536 |
| Molecular Formula | C8H12BrN3 |
| Molecular Weight | 230.11 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | N-(2-bromoprop-2-enyl)-N,1-dimethylpyrazol-4-amine |
| SMILES | C=C(Br)CN(C)c1cnn(C)c1 |
| InChI | InChI=1S/C8H12BrN3/c1-7(9)5-11(2)8-4-10-12(3)6-8/h4,6H,1,5H2,2-3H3 |
| InChIKey | JARIWYZBJJZITM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.11 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |