C22H47N3Si2 — CID 140624353
1-methyl-N,N-bis(tripropylsilyl)pyrazol-4-amine (PubChem CID 140624353) has the molecular formula C22H47N3Si2 and a molecular weight of 409.81 g/mol. Its IUPAC name is 1-methyl-N,N-bis(tripropylsilyl)pyrazol-4-amine.
| Compound Name | 1-methyl-N,N-bis(tripropylsilyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 140624353 |
| Molecular Formula | C22H47N3Si2 |
| Molecular Weight | 409.81 g/mol |
| Exact Mass | 409.33 |
| IUPAC Name | 1-methyl-N,N-bis(tripropylsilyl)pyrazol-4-amine |
| SMILES | CCC[Si](CCC)(CCC)N(c1cnn(C)c1)[Si](CCC)(CCC)CCC |
| InChI | InChI=1S/C22H47N3Si2/c1-8-14-26(15-9-2,16-10-3)25(22-20-23-24(7)21-22)27(17-11-4,18-12-5)19-13-6/h20-21H,8-19H2,1-7H3 |
| InChIKey | VHLGEJOOVRFPEJ-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.81 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|