C23H23N3Si — CID 140624452
N,1-dimethyl-N-triphenylsilylpyrazol-4-amine (PubChem CID 140624452) has the molecular formula C23H23N3Si and a molecular weight of 369.54 g/mol. Its IUPAC name is N,1-dimethyl-N-triphenylsilylpyrazol-4-amine.
| Compound Name | N,1-dimethyl-N-triphenylsilylpyrazol-4-amine |
|---|---|
| PubChem CID | 140624452 |
| Molecular Formula | C23H23N3Si |
| Molecular Weight | 369.54 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N,1-dimethyl-N-triphenylsilylpyrazol-4-amine |
| SMILES | CN(c1cnn(C)c1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H23N3Si/c1-25-19-20(18-24-25)26(2)27(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-19H,1-2H3 |
| InChIKey | YQHYLIRWGXUHBB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.54 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|