About N-ethyl-N-triphenylsilylpteridin-7-amine
N-ethyl-N-triphenylsilylpteridin-7-amine (PubChem CID 140624754) has the molecular formula C26H23N5Si
and a molecular weight of 433.59 g/mol. Its IUPAC name is N-ethyl-N-triphenylsilylpteridin-7-amine.
Molecular Properties
| Compound Name | N-ethyl-N-triphenylsilylpteridin-7-amine |
| PubChem CID | 140624754 |
| Molecular Formula | C26H23N5Si |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | N-ethyl-N-triphenylsilylpteridin-7-amine |
| SMILES | CCN(c1cnc2cncnc2n1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H23N5Si/c1-2-31(25-19-28-24-18-27-20-29-26(24)30-25)32(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-20H,2H2,1H3 |
| InChIKey | KFVVSLFOHYMORW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-triphenylsilylpteridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-triphenylsilylpteridin-7-amine?
The IUPAC name of N-ethyl-N-triphenylsilylpteridin-7-amine (CID 140624754) is N-ethyl-N-triphenylsilylpteridin-7-amine.
What is the SMILES notation for N-ethyl-N-triphenylsilylpteridin-7-amine?
The canonical SMILES for N-ethyl-N-triphenylsilylpteridin-7-amine is CCN(c1cnc2cncnc2n1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of N-ethyl-N-triphenylsilylpteridin-7-amine?
The InChIKey is KFVVSLFOHYMORW-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23N5Si/c1-2-31(25-19-28-24-18-27-20-29-26(24)30-25)32(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-20H,2H2,1H3.
What are the key properties of N-ethyl-N-triphenylsilylpteridin-7-amine?
N-ethyl-N-triphenylsilylpteridin-7-amine has a molecular weight of 433.59 g/mol, XLogP of 2.91, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-triphenylsilylpteridin-7-amine is sourced from PubChem (CID 140624754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).