C11H22N6O6 — CID 139681291
1-[2-[(1-hydroxy-2,2-dimethoxyethyl)amino]-2-(1,3,5-triazin-2-yl)hydrazinyl]-2,2-dimethoxyethanol (PubChem CID 139681291) has the molecular formula C11H22N6O6 and a molecular weight of 334.33 g/mol. Its IUPAC name is 1-[2-[(1-hydroxy-2,2-dimethoxyethyl)amino]-2-(1,3,5-triazin-2-yl)hydrazinyl]-2,2-dimethoxyethanol.
| Compound Name | 1-[2-[(1-hydroxy-2,2-dimethoxyethyl)amino]-2-(1,3,5-triazin-2-yl)hydrazinyl]-2,2-dimethoxyethanol |
|---|---|
| PubChem CID | 139681291 |
| Molecular Formula | C11H22N6O6 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 1-[2-[(1-hydroxy-2,2-dimethoxyethyl)amino]-2-(1,3,5-triazin-2-yl)hydrazinyl]-2,2-dimethoxyethanol |
| SMILES | COC(OC)C(O)NN(NC(O)C(OC)OC)c1ncncn1 |
| InChI | InChI=1S/C11H22N6O6/c1-20-9(21-2)7(18)15-17(11-13-5-12-6-14-11)16-8(19)10(22-3)23-4/h5-10,15-16,18-19H,1-4H3 |
| InChIKey | MFJONNYANCPBIC-UHFFFAOYSA-N |
| XLogP | -2.44 |
| TPSA | 143.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|