C9H10BrF4N3O — CID 114072952
5-bromo-N-ethyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-amine (PubChem CID 114072952) has the molecular formula C9H10BrF4N3O and a molecular weight of 332.10 g/mol. Its IUPAC name is 5-bromo-N-ethyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-amine.
| Compound Name | 5-bromo-N-ethyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114072952 |
| Molecular Formula | C9H10BrF4N3O |
| Molecular Weight | 332.10 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | 5-bromo-N-ethyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-amine |
| SMILES | CCNc1ncnc(OCC(F)(F)C(F)F)c1Br |
| InChI | InChI=1S/C9H10BrF4N3O/c1-2-15-6-5(10)7(17-4-16-6)18-3-9(13,14)8(11)12/h4,8H,2-3H2,1H3,(H,15,16,17) |
| InChIKey | XSGZDQGGVGBTCW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.10 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|