C10H14F4N4O — CID 81000943
[2-ethyl-5-methyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-yl]hydrazine (PubChem CID 81000943) has the molecular formula C10H14F4N4O and a molecular weight of 282.24 g/mol. Its IUPAC name is [2-ethyl-5-methyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-yl]hydrazine.
| Compound Name | [2-ethyl-5-methyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 81000943 |
| Molecular Formula | C10H14F4N4O |
| Molecular Weight | 282.24 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | [2-ethyl-5-methyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-yl]hydrazine |
| SMILES | CCc1nc(NN)c(C)c(OCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C10H14F4N4O/c1-3-6-16-7(18-15)5(2)8(17-6)19-4-10(13,14)9(11)12/h9H,3-4,15H2,1-2H3,(H,16,17,18) |
| InChIKey | YNFWRHSPGSKWRQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|