C10H15N7O — CID 106598871
[2-ethyl-5-methyl-6-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyrimidin-4-yl]hydrazine (PubChem CID 106598871) has the molecular formula C10H15N7O and a molecular weight of 249.28 g/mol. Its IUPAC name is [2-ethyl-5-methyl-6-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-ethyl-5-methyl-6-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 106598871 |
| Molecular Formula | C10H15N7O |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | [2-ethyl-5-methyl-6-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyrimidin-4-yl]hydrazine |
| SMILES | CCc1nc(NN)c(C)c(Oc2ncn(C)n2)n1 |
| InChI | InChI=1S/C10H15N7O/c1-4-7-13-8(15-11)6(2)9(14-7)18-10-12-5-17(3)16-10/h5H,4,11H2,1-3H3,(H,13,14,15) |
| InChIKey | LHBHNZWETJNQLF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|