C8H8Cl2N6O — CID 106598864
[3,5-dichloro-6-[(1-methyl-1,2,4-triazol-3-yl)oxy]-2-pyridinyl]hydrazine (PubChem CID 106598864) has the molecular formula C8H8Cl2N6O and a molecular weight of 275.10 g/mol. Its IUPAC name is [3,5-dichloro-6-[(1-methyl-1,2,4-triazol-3-yl)oxy]-2-pyridinyl]hydrazine.
| Compound Name | [3,5-dichloro-6-[(1-methyl-1,2,4-triazol-3-yl)oxy]-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 106598864 |
| Molecular Formula | C8H8Cl2N6O |
| Molecular Weight | 275.10 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | [3,5-dichloro-6-[(1-methyl-1,2,4-triazol-3-yl)oxy]-2-pyridinyl]hydrazine |
| SMILES | Cn1cnc(Oc2nc(NN)c(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C8H8Cl2N6O/c1-16-3-12-8(15-16)17-7-5(10)2-4(9)6(13-7)14-11/h2-3H,11H2,1H3,(H,13,14) |
| InChIKey | ZIBKONVAAGGIHC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.10 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|