C12H10Cl2N4O2 — CID 102762897
4-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)oxy]benzamide (PubChem CID 102762897) has the molecular formula C12H10Cl2N4O2 and a molecular weight of 313.14 g/mol. Its IUPAC name is 4-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)oxy]benzamide.
| Compound Name | 4-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)oxy]benzamide |
|---|---|
| PubChem CID | 102762897 |
| Molecular Formula | C12H10Cl2N4O2 |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 4-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)oxy]benzamide |
| SMILES | NNc1nc(Oc2ccc(C(N)=O)cc2)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H10Cl2N4O2/c13-8-5-9(14)12(17-11(8)18-16)20-7-3-1-6(2-4-7)10(15)19/h1-5H,16H2,(H2,15,19)(H,17,18) |
| InChIKey | TVTKUQXJMMIWJU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|