C12H11Cl2N3O3S — CID 102762928
[3,5-dichloro-6-(4-methylsulfonylphenoxy)-2-pyridinyl]hydrazine (PubChem CID 102762928) has the molecular formula C12H11Cl2N3O3S and a molecular weight of 348.21 g/mol. Its IUPAC name is [3,5-dichloro-6-(4-methylsulfonylphenoxy)-2-pyridinyl]hydrazine.
| Compound Name | [3,5-dichloro-6-(4-methylsulfonylphenoxy)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 102762928 |
| Molecular Formula | C12H11Cl2N3O3S |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | [3,5-dichloro-6-(4-methylsulfonylphenoxy)-2-pyridinyl]hydrazine |
| SMILES | CS(=O)(=O)c1ccc(Oc2nc(NN)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C12H11Cl2N3O3S/c1-21(18,19)8-4-2-7(3-5-8)20-12-10(14)6-9(13)11(16-12)17-15/h2-6H,15H2,1H3,(H,16,17) |
| InChIKey | ZJXJBHHUKZEDBC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|