C12H10Cl2N2O3S — CID 102760799
3,5-dichloro-6-(3-methylsulfonylphenoxy)pyridin-2-amine (PubChem CID 102760799) has the molecular formula C12H10Cl2N2O3S and a molecular weight of 333.20 g/mol. Its IUPAC name is 3,5-dichloro-6-(3-methylsulfonylphenoxy)pyridin-2-amine.
| Compound Name | 3,5-dichloro-6-(3-methylsulfonylphenoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 102760799 |
| Molecular Formula | C12H10Cl2N2O3S |
| Molecular Weight | 333.20 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | 3,5-dichloro-6-(3-methylsulfonylphenoxy)pyridin-2-amine |
| SMILES | CS(=O)(=O)c1cccc(Oc2nc(N)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C12H10Cl2N2O3S/c1-20(17,18)8-4-2-3-7(5-8)19-12-10(14)6-9(13)11(15)16-12/h2-6H,1H3,(H2,15,16) |
| InChIKey | FXSVXTMMIGIEKX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.20 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |