C13H12N4O3S — CID 80874626
8-(3-methylsulfonylphenoxy)imidazo[1,2-a]pyrazin-6-amine (PubChem CID 80874626) has the molecular formula C13H12N4O3S and a molecular weight of 304.33 g/mol. Its IUPAC name is 8-(3-methylsulfonylphenoxy)imidazo[1,2-a]pyrazin-6-amine.
| Compound Name | 8-(3-methylsulfonylphenoxy)imidazo[1,2-a]pyrazin-6-amine |
|---|---|
| PubChem CID | 80874626 |
| Molecular Formula | C13H12N4O3S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 8-(3-methylsulfonylphenoxy)imidazo[1,2-a]pyrazin-6-amine |
| SMILES | CS(=O)(=O)c1cccc(Oc2nc(N)cn3ccnc23)c1 |
| InChI | InChI=1S/C13H12N4O3S/c1-21(18,19)10-4-2-3-9(7-10)20-13-12-15-5-6-17(12)8-11(14)16-13/h2-8H,14H2,1H3 |
| InChIKey | FXBDEWLOYQKVOV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |