C11H13N7OS — CID 106598874
[6-ethyl-4-[(1-methyl-1,2,4-triazol-3-yl)oxy]thieno[2,3-d]pyrimidin-2-yl]hydrazine (PubChem CID 106598874) has the molecular formula C11H13N7OS and a molecular weight of 291.34 g/mol. Its IUPAC name is [6-ethyl-4-[(1-methyl-1,2,4-triazol-3-yl)oxy]thieno[2,3-d]pyrimidin-2-yl]hydrazine.
| Compound Name | [6-ethyl-4-[(1-methyl-1,2,4-triazol-3-yl)oxy]thieno[2,3-d]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 106598874 |
| Molecular Formula | C11H13N7OS |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | [6-ethyl-4-[(1-methyl-1,2,4-triazol-3-yl)oxy]thieno[2,3-d]pyrimidin-2-yl]hydrazine |
| SMILES | CCc1cc2c(Oc3ncn(C)n3)nc(NN)nc2s1 |
| InChI | InChI=1S/C11H13N7OS/c1-3-6-4-7-8(19-11-13-5-18(2)17-11)14-10(16-12)15-9(7)20-6/h4-5H,3,12H2,1-2H3,(H,14,15,16) |
| InChIKey | PGYSQPYMQDHZFM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|