C14H18N6S — CID 103335947
[6-ethyl-4-(3,4,5-trimethylpyrazol-1-yl)thieno[2,3-d]pyrimidin-2-yl]hydrazine (PubChem CID 103335947) has the molecular formula C14H18N6S and a molecular weight of 302.41 g/mol. Its IUPAC name is [6-ethyl-4-(3,4,5-trimethylpyrazol-1-yl)thieno[2,3-d]pyrimidin-2-yl]hydrazine.
| Compound Name | [6-ethyl-4-(3,4,5-trimethylpyrazol-1-yl)thieno[2,3-d]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 103335947 |
| Molecular Formula | C14H18N6S |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [6-ethyl-4-(3,4,5-trimethylpyrazol-1-yl)thieno[2,3-d]pyrimidin-2-yl]hydrazine |
| SMILES | CCc1cc2c(-n3nc(C)c(C)c3C)nc(NN)nc2s1 |
| InChI | InChI=1S/C14H18N6S/c1-5-10-6-11-12(16-14(18-15)17-13(11)21-10)20-9(4)7(2)8(3)19-20/h6H,5,15H2,1-4H3,(H,16,17,18) |
| InChIKey | LOVJPQZICHJOLT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|