C13H18N6OS — CID 103333589
1-(6-ethyl-2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)-1,4-diazepan-5-one (PubChem CID 103333589) has the molecular formula C13H18N6OS and a molecular weight of 306.40 g/mol. Its IUPAC name is 1-(6-ethyl-2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)-1,4-diazepan-5-one.
| Compound Name | 1-(6-ethyl-2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 103333589 |
| Molecular Formula | C13H18N6OS |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 1-(6-ethyl-2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)-1,4-diazepan-5-one |
| SMILES | CCc1cc2c(N3CCNC(=O)CC3)nc(NN)nc2s1 |
| InChI | InChI=1S/C13H18N6OS/c1-2-8-7-9-11(16-13(18-14)17-12(9)21-8)19-5-3-10(20)15-4-6-19/h7H,2-6,14H2,1H3,(H,15,20)(H,16,17,18) |
| InChIKey | BMIQTBNIZKCMJK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|