C10H15N3OS — CID 157138436
1-(5-ethyl-1,3-thiazol-2-yl)-1,4-diazepan-5-one (PubChem CID 157138436) has the molecular formula C10H15N3OS and a molecular weight of 225.32 g/mol. Its IUPAC name is 1-(5-ethyl-1,3-thiazol-2-yl)-1,4-diazepan-5-one.
| Compound Name | 1-(5-ethyl-1,3-thiazol-2-yl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 157138436 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 1-(5-ethyl-1,3-thiazol-2-yl)-1,4-diazepan-5-one |
| SMILES | CCc1cnc(N2CCNC(=O)CC2)s1 |
| InChI | InChI=1S/C10H15N3OS/c1-2-8-7-12-10(15-8)13-5-3-9(14)11-4-6-13/h7H,2-6H2,1H3,(H,11,14) |
| InChIKey | RREMYTVNBQPYOM-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |