C10H13N3O3S — CID 126697202
[2-(4-oxopiperidin-1-yl)-1,3-thiazol-5-yl]methyl carbamate (PubChem CID 126697202) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is [2-(4-oxopiperidin-1-yl)-1,3-thiazol-5-yl]methyl carbamate.
| Compound Name | [2-(4-oxopiperidin-1-yl)-1,3-thiazol-5-yl]methyl carbamate |
|---|---|
| PubChem CID | 126697202 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | [2-(4-oxopiperidin-1-yl)-1,3-thiazol-5-yl]methyl carbamate |
| SMILES | NC(=O)OCc1cnc(N2CCC(=O)CC2)s1 |
| InChI | InChI=1S/C10H13N3O3S/c11-9(15)16-6-8-5-12-10(17-8)13-3-1-7(14)2-4-13/h5H,1-4,6H2,(H2,11,15) |
| InChIKey | XSMPNTWXIQKJFZ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |