C12H13N7OS — CID 103335986
1-(6-ethyl-2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)pyrazole-4-carboxamide (PubChem CID 103335986) has the molecular formula C12H13N7OS and a molecular weight of 303.35 g/mol. Its IUPAC name is 1-(6-ethyl-2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)pyrazole-4-carboxamide.
| Compound Name | 1-(6-ethyl-2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 103335986 |
| Molecular Formula | C12H13N7OS |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 1-(6-ethyl-2-hydrazinylthieno[2,3-d]pyrimidin-4-yl)pyrazole-4-carboxamide |
| SMILES | CCc1cc2c(-n3cc(C(N)=O)cn3)nc(NN)nc2s1 |
| InChI | InChI=1S/C12H13N7OS/c1-2-7-3-8-10(16-12(18-14)17-11(8)21-7)19-5-6(4-15-19)9(13)20/h3-5H,2,14H2,1H3,(H2,13,20)(H,16,17,18) |
| InChIKey | RBFZLANWSBPNSC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 124.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|