C14H21N5OS — CID 103332305
[4-(2,5-dimethylmorpholin-4-yl)-6-ethylthieno[2,3-d]pyrimidin-2-yl]hydrazine (PubChem CID 103332305) has the molecular formula C14H21N5OS and a molecular weight of 307.42 g/mol. Its IUPAC name is [4-(2,5-dimethylmorpholin-4-yl)-6-ethylthieno[2,3-d]pyrimidin-2-yl]hydrazine.
| Compound Name | [4-(2,5-dimethylmorpholin-4-yl)-6-ethylthieno[2,3-d]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 103332305 |
| Molecular Formula | C14H21N5OS |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | [4-(2,5-dimethylmorpholin-4-yl)-6-ethylthieno[2,3-d]pyrimidin-2-yl]hydrazine |
| SMILES | CCc1cc2c(N3CC(C)OCC3C)nc(NN)nc2s1 |
| InChI | InChI=1S/C14H21N5OS/c1-4-10-5-11-12(16-14(18-15)17-13(11)21-10)19-6-9(3)20-7-8(19)2/h5,8-9H,4,6-7,15H2,1-3H3,(H,16,17,18) |
| InChIKey | INBRLMCMOYVSRO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|