C13H19N5S — CID 103335822
[4-(2,4-dimethylpyrrolidin-1-yl)-6-methylthieno[2,3-d]pyrimidin-2-yl]hydrazine (PubChem CID 103335822) has the molecular formula C13H19N5S and a molecular weight of 277.40 g/mol. Its IUPAC name is [4-(2,4-dimethylpyrrolidin-1-yl)-6-methylthieno[2,3-d]pyrimidin-2-yl]hydrazine.
| Compound Name | [4-(2,4-dimethylpyrrolidin-1-yl)-6-methylthieno[2,3-d]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 103335822 |
| Molecular Formula | C13H19N5S |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | [4-(2,4-dimethylpyrrolidin-1-yl)-6-methylthieno[2,3-d]pyrimidin-2-yl]hydrazine |
| SMILES | Cc1cc2c(N3CC(C)CC3C)nc(NN)nc2s1 |
| InChI | InChI=1S/C13H19N5S/c1-7-4-8(2)18(6-7)11-10-5-9(3)19-12(10)16-13(15-11)17-14/h5,7-8H,4,6,14H2,1-3H3,(H,15,16,17) |
| InChIKey | NZTZVKVMKMOSPL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|