C14H22N6S — CID 103332383
[6-methyl-4-(4-propan-2-ylpiperazin-1-yl)thieno[2,3-d]pyrimidin-2-yl]hydrazine (PubChem CID 103332383) has the molecular formula C14H22N6S and a molecular weight of 306.44 g/mol. Its IUPAC name is [6-methyl-4-(4-propan-2-ylpiperazin-1-yl)thieno[2,3-d]pyrimidin-2-yl]hydrazine.
| Compound Name | [6-methyl-4-(4-propan-2-ylpiperazin-1-yl)thieno[2,3-d]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 103332383 |
| Molecular Formula | C14H22N6S |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | [6-methyl-4-(4-propan-2-ylpiperazin-1-yl)thieno[2,3-d]pyrimidin-2-yl]hydrazine |
| SMILES | Cc1cc2c(N3CCN(C(C)C)CC3)nc(NN)nc2s1 |
| InChI | InChI=1S/C14H22N6S/c1-9(2)19-4-6-20(7-5-19)12-11-8-10(3)21-13(11)17-14(16-12)18-15/h8-9H,4-7,15H2,1-3H3,(H,16,17,18) |
| InChIKey | YBIKNQLUDCQYJN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|