C14H19N5OS — CID 103333144
[4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-6-methylthieno[2,3-d]pyrimidin-2-yl]hydrazine (PubChem CID 103333144) has the molecular formula C14H19N5OS and a molecular weight of 305.41 g/mol. Its IUPAC name is [4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-6-methylthieno[2,3-d]pyrimidin-2-yl]hydrazine.
| Compound Name | [4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-6-methylthieno[2,3-d]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 103333144 |
| Molecular Formula | C14H19N5OS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | [4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-6-methylthieno[2,3-d]pyrimidin-2-yl]hydrazine |
| SMILES | Cc1cc2c(N3CCOC4CCCC43)nc(NN)nc2s1 |
| InChI | InChI=1S/C14H19N5OS/c1-8-7-9-12(16-14(18-15)17-13(9)21-8)19-5-6-20-11-4-2-3-10(11)19/h7,10-11H,2-6,15H2,1H3,(H,16,17,18) |
| InChIKey | FZEALRMIINCRIC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|