C13H18ClN3O — CID 63727983
4-(6-chloro-2,5-dimethylpyrimidin-4-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 63727983) has the molecular formula C13H18ClN3O and a molecular weight of 267.76 g/mol. Its IUPAC name is 4-(6-chloro-2,5-dimethylpyrimidin-4-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | 4-(6-chloro-2,5-dimethylpyrimidin-4-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 63727983 |
| Molecular Formula | C13H18ClN3O |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 4-(6-chloro-2,5-dimethylpyrimidin-4-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | Cc1nc(Cl)c(C)c(N2CCOC3CCCC32)n1 |
| InChI | InChI=1S/C13H18ClN3O/c1-8-12(14)15-9(2)16-13(8)17-6-7-18-11-5-3-4-10(11)17/h10-11H,3-7H2,1-2H3 |
| InChIKey | WNVKPTUJVCSNLF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |