C14H22N6O — CID 81000859
[5-methyl-2-propyl-6-(1,3,5-trimethylpyrazol-4-yl)oxypyrimidin-4-yl]hydrazine (PubChem CID 81000859) has the molecular formula C14H22N6O and a molecular weight of 290.37 g/mol. Its IUPAC name is [5-methyl-2-propyl-6-(1,3,5-trimethylpyrazol-4-yl)oxypyrimidin-4-yl]hydrazine.
| Compound Name | [5-methyl-2-propyl-6-(1,3,5-trimethylpyrazol-4-yl)oxypyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 81000859 |
| Molecular Formula | C14H22N6O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | [5-methyl-2-propyl-6-(1,3,5-trimethylpyrazol-4-yl)oxypyrimidin-4-yl]hydrazine |
| SMILES | CCCc1nc(NN)c(C)c(Oc2c(C)nn(C)c2C)n1 |
| InChI | InChI=1S/C14H22N6O/c1-6-7-11-16-13(18-15)8(2)14(17-11)21-12-9(3)19-20(5)10(12)4/h6-7,15H2,1-5H3,(H,16,17,18) |
| InChIKey | UXTSZPFQIGNFCT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|